C15H9ClF2O3 — CID 107475799
(2-chloro-4,5-difluorophenyl)-(2,3-dihydro-1,4-benzodioxin-3-yl)methanone (PubChem CID 107475799) has the molecular formula C15H9ClF2O3 and a molecular weight of 310.68 g/mol. Its IUPAC name is (2-chloro-4,5-difluorophenyl)-(2,3-dihydro-1,4-benzodioxin-3-yl)methanone.
| Compound Name | (2-chloro-4,5-difluorophenyl)-(2,3-dihydro-1,4-benzodioxin-3-yl)methanone |
|---|---|
| PubChem CID | 107475799 |
| Molecular Formula | C15H9ClF2O3 |
| Molecular Weight | 310.68 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | (2-chloro-4,5-difluorophenyl)-(2,3-dihydro-1,4-benzodioxin-3-yl)methanone |
| SMILES | O=C(c1cc(F)c(F)cc1Cl)C1COc2ccccc2O1 |
| InChI | InChI=1S/C15H9ClF2O3/c16-9-6-11(18)10(17)5-8(9)15(19)14-7-20-12-3-1-2-4-13(12)21-14/h1-6,14H,7H2 |
| InChIKey | UHSQUNLERUTKJJ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.68 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|