C15H14ClF2NS — CID 107476054
(2-chloro-4,5-difluorophenyl)-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)methanamine (PubChem CID 107476054) has the molecular formula C15H14ClF2NS and a molecular weight of 313.80 g/mol. Its IUPAC name is (2-chloro-4,5-difluorophenyl)-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)methanamine.
| Compound Name | (2-chloro-4,5-difluorophenyl)-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)methanamine |
|---|---|
| PubChem CID | 107476054 |
| Molecular Formula | C15H14ClF2NS |
| Molecular Weight | 313.80 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | (2-chloro-4,5-difluorophenyl)-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)methanamine |
| SMILES | NC(c1cc2c(s1)CCCC2)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C15H14ClF2NS/c16-10-7-12(18)11(17)6-9(10)15(19)14-5-8-3-1-2-4-13(8)20-14/h5-7,15H,1-4,19H2 |
| InChIKey | XOIANYGGRYHPLK-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.80 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|