C15H14ClF2NS2 — CID 107476199
1-(2-chloro-4,5-difluorophenyl)-1-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)-N-methylmethanamine (PubChem CID 107476199) has the molecular formula C15H14ClF2NS2 and a molecular weight of 345.87 g/mol. Its IUPAC name is 1-(2-chloro-4,5-difluorophenyl)-1-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)-N-methylmethanamine.
| Compound Name | 1-(2-chloro-4,5-difluorophenyl)-1-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 107476199 |
| Molecular Formula | C15H14ClF2NS2 |
| Molecular Weight | 345.87 g/mol |
| Exact Mass | 345.02 |
| IUPAC Name | 1-(2-chloro-4,5-difluorophenyl)-1-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)-N-methylmethanamine |
| SMILES | CNC(c1cc2c(s1)CCSC2)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C15H14ClF2NS2/c1-19-15(9-5-11(17)12(18)6-10(9)16)14-4-8-7-20-3-2-13(8)21-14/h4-6,15,19H,2-3,7H2,1H3 |
| InChIKey | XDMPEDRNMVYQMY-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.87 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|