C13H12ClF2NOS — CID 107476237
1-(2-chloro-4,5-difluorophenyl)-1-(4-methoxythiophen-2-yl)-N-methylmethanamine (PubChem CID 107476237) has the molecular formula C13H12ClF2NOS and a molecular weight of 303.76 g/mol. Its IUPAC name is 1-(2-chloro-4,5-difluorophenyl)-1-(4-methoxythiophen-2-yl)-N-methylmethanamine.
| Compound Name | 1-(2-chloro-4,5-difluorophenyl)-1-(4-methoxythiophen-2-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 107476237 |
| Molecular Formula | C13H12ClF2NOS |
| Molecular Weight | 303.76 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | 1-(2-chloro-4,5-difluorophenyl)-1-(4-methoxythiophen-2-yl)-N-methylmethanamine |
| SMILES | CNC(c1cc(OC)cs1)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C13H12ClF2NOS/c1-17-13(12-3-7(18-2)6-19-12)8-4-10(15)11(16)5-9(8)14/h3-6,13,17H,1-2H3 |
| InChIKey | MBTHCQKZKGYASE-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.76 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|