C14H18ClF2NO — CID 107476423
1-(2-chloro-4,5-difluorophenyl)-N-ethyl-2-(oxolan-2-yl)ethanamine (PubChem CID 107476423) has the molecular formula C14H18ClF2NO and a molecular weight of 289.75 g/mol. Its IUPAC name is 1-(2-chloro-4,5-difluorophenyl)-N-ethyl-2-(oxolan-2-yl)ethanamine.
| Compound Name | 1-(2-chloro-4,5-difluorophenyl)-N-ethyl-2-(oxolan-2-yl)ethanamine |
|---|---|
| PubChem CID | 107476423 |
| Molecular Formula | C14H18ClF2NO |
| Molecular Weight | 289.75 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 1-(2-chloro-4,5-difluorophenyl)-N-ethyl-2-(oxolan-2-yl)ethanamine |
| SMILES | CCNC(CC1CCCO1)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C14H18ClF2NO/c1-2-18-14(6-9-4-3-5-19-9)10-7-12(16)13(17)8-11(10)15/h7-9,14,18H,2-6H2,1H3 |
| InChIKey | BFJHZKGEBCDWKV-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.75 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|