C13H12ClF2NS — CID 107476439
N-[(2-chloro-4,5-difluorophenyl)-thiophen-2-ylmethyl]ethanamine (PubChem CID 107476439) has the molecular formula C13H12ClF2NS and a molecular weight of 287.76 g/mol. Its IUPAC name is N-[(2-chloro-4,5-difluorophenyl)-thiophen-2-ylmethyl]ethanamine.
| Compound Name | N-[(2-chloro-4,5-difluorophenyl)-thiophen-2-ylmethyl]ethanamine |
|---|---|
| PubChem CID | 107476439 |
| Molecular Formula | C13H12ClF2NS |
| Molecular Weight | 287.76 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | N-[(2-chloro-4,5-difluorophenyl)-thiophen-2-ylmethyl]ethanamine |
| SMILES | CCNC(c1cccs1)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C13H12ClF2NS/c1-2-17-13(12-4-3-5-18-12)8-6-10(15)11(16)7-9(8)14/h3-7,13,17H,2H2,1H3 |
| InChIKey | UNIVKKMQRAKJGL-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.76 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|