C15H20ClF2N — CID 107476482
N-[(2-chloro-4,5-difluorophenyl)-(1-methylcyclopentyl)methyl]ethanamine (PubChem CID 107476482) has the molecular formula C15H20ClF2N and a molecular weight of 287.78 g/mol. Its IUPAC name is N-[(2-chloro-4,5-difluorophenyl)-(1-methylcyclopentyl)methyl]ethanamine.
| Compound Name | N-[(2-chloro-4,5-difluorophenyl)-(1-methylcyclopentyl)methyl]ethanamine |
|---|---|
| PubChem CID | 107476482 |
| Molecular Formula | C15H20ClF2N |
| Molecular Weight | 287.78 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | N-[(2-chloro-4,5-difluorophenyl)-(1-methylcyclopentyl)methyl]ethanamine |
| SMILES | CCNC(c1cc(F)c(F)cc1Cl)C1(C)CCCC1 |
| InChI | InChI=1S/C15H20ClF2N/c1-3-19-14(15(2)6-4-5-7-15)10-8-12(17)13(18)9-11(10)16/h8-9,14,19H,3-7H2,1-2H3 |
| InChIKey | OFDRZHDKRFFHKS-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.78 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|