About 1-[3-(2-chloro-4,5-difluorophenyl)phenyl]-N-ethylpropan-1-amine
1-[3-(2-chloro-4,5-difluorophenyl)phenyl]-N-ethylpropan-1-amine (PubChem CID 107476919) has the molecular formula C17H18ClF2N
and a molecular weight of 309.79 g/mol. Its IUPAC name is 1-[3-(2-chloro-4,5-difluorophenyl)phenyl]-N-ethylpropan-1-amine.
Molecular Properties
| Compound Name | 1-[3-(2-chloro-4,5-difluorophenyl)phenyl]-N-ethylpropan-1-amine |
| PubChem CID | 107476919 |
| Molecular Formula | C17H18ClF2N |
| Molecular Weight | 309.79 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 1-[3-(2-chloro-4,5-difluorophenyl)phenyl]-N-ethylpropan-1-amine |
| SMILES | CCNC(CC)c1cccc(-c2cc(F)c(F)cc2Cl)c1 |
| InChI | InChI=1S/C17H18ClF2N/c1-3-17(21-4-2)12-7-5-6-11(8-12)13-9-15(19)16(20)10-14(13)18/h5-10,17,21H,3-4H2,1-2H3 |
| InChIKey | HOOUTZDNSOMUTF-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 309.79 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-(2-chloro-4,5-difluorophenyl)phenyl]-N-ethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(2-chloro-4,5-difluorophenyl)phenyl]-N-ethylpropan-1-amine?
The IUPAC name of 1-[3-(2-chloro-4,5-difluorophenyl)phenyl]-N-ethylpropan-1-amine (CID 107476919) is 1-[3-(2-chloro-4,5-difluorophenyl)phenyl]-N-ethylpropan-1-amine.
What is the SMILES notation for 1-[3-(2-chloro-4,5-difluorophenyl)phenyl]-N-ethylpropan-1-amine?
The canonical SMILES for 1-[3-(2-chloro-4,5-difluorophenyl)phenyl]-N-ethylpropan-1-amine is CCNC(CC)c1cccc(-c2cc(F)c(F)cc2Cl)c1.
What is the InChIKey of 1-[3-(2-chloro-4,5-difluorophenyl)phenyl]-N-ethylpropan-1-amine?
The InChIKey is HOOUTZDNSOMUTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18ClF2N/c1-3-17(21-4-2)12-7-5-6-11(8-12)13-9-15(19)16(20)10-14(13)18/h5-10,17,21H,3-4H2,1-2H3.
What are the key properties of 1-[3-(2-chloro-4,5-difluorophenyl)phenyl]-N-ethylpropan-1-amine?
1-[3-(2-chloro-4,5-difluorophenyl)phenyl]-N-ethylpropan-1-amine has a molecular weight of 309.79 g/mol, XLogP of 5.35, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(2-chloro-4,5-difluorophenyl)phenyl]-N-ethylpropan-1-amine is sourced from PubChem (CID 107476919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).