C11H13F2N3O3 — CID 107478207
6-amino-5-[2,2-difluoroethyl(2-hydroxyethyl)amino]-3H-1,3-benzoxazol-2-one (PubChem CID 107478207) has the molecular formula C11H13F2N3O3 and a molecular weight of 273.24 g/mol. Its IUPAC name is 6-amino-5-[2,2-difluoroethyl(2-hydroxyethyl)amino]-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-amino-5-[2,2-difluoroethyl(2-hydroxyethyl)amino]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 107478207 |
| Molecular Formula | C11H13F2N3O3 |
| Molecular Weight | 273.24 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 6-amino-5-[2,2-difluoroethyl(2-hydroxyethyl)amino]-3H-1,3-benzoxazol-2-one |
| SMILES | Nc1cc2oc(=O)[nH]c2cc1N(CCO)CC(F)F |
| InChI | InChI=1S/C11H13F2N3O3/c12-10(13)5-16(1-2-17)8-4-7-9(3-6(8)14)19-11(18)15-7/h3-4,10,17H,1-2,5,14H2,(H,15,18) |
| InChIKey | PWLZXBMURCGXDY-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 95.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.24 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|