C11H15BrF2N2O — CID 107478617
2-[(2-amino-6-bromophenyl)methyl-(2,2-difluoroethyl)amino]ethanol (PubChem CID 107478617) has the molecular formula C11H15BrF2N2O and a molecular weight of 309.15 g/mol. Its IUPAC name is 2-[(2-amino-6-bromophenyl)methyl-(2,2-difluoroethyl)amino]ethanol.
| Compound Name | 2-[(2-amino-6-bromophenyl)methyl-(2,2-difluoroethyl)amino]ethanol |
|---|---|
| PubChem CID | 107478617 |
| Molecular Formula | C11H15BrF2N2O |
| Molecular Weight | 309.15 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | 2-[(2-amino-6-bromophenyl)methyl-(2,2-difluoroethyl)amino]ethanol |
| SMILES | Nc1cccc(Br)c1CN(CCO)CC(F)F |
| InChI | InChI=1S/C11H15BrF2N2O/c12-9-2-1-3-10(15)8(9)6-16(4-5-17)7-11(13)14/h1-3,11,17H,4-7,15H2 |
| InChIKey | KWBIAWCAWZLHRH-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.15 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|