C6H14F2N2O — CID 107478674
2-[2-aminoethyl(2,2-difluoroethyl)amino]ethanol (PubChem CID 107478674) has the molecular formula C6H14F2N2O and a molecular weight of 168.19 g/mol. Its IUPAC name is 2-[2-aminoethyl(2,2-difluoroethyl)amino]ethanol.
| Compound Name | 2-[2-aminoethyl(2,2-difluoroethyl)amino]ethanol |
|---|---|
| PubChem CID | 107478674 |
| Molecular Formula | C6H14F2N2O |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.11 |
| IUPAC Name | 2-[2-aminoethyl(2,2-difluoroethyl)amino]ethanol |
| SMILES | NCCN(CCO)CC(F)F |
| InChI | InChI=1S/C6H14F2N2O/c7-6(8)5-10(2-1-9)3-4-11/h6,11H,1-5,9H2 |
| InChIKey | JOQQDKXKLPREON-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |