About 2-[5-aminopentyl(2,2-difluoroethyl)amino]ethanol
2-[5-aminopentyl(2,2-difluoroethyl)amino]ethanol (PubChem CID 107478848) has the molecular formula C9H20F2N2O
and a molecular weight of 210.27 g/mol. Its IUPAC name is 2-[5-aminopentyl(2,2-difluoroethyl)amino]ethanol.
Molecular Properties
| Compound Name | 2-[5-aminopentyl(2,2-difluoroethyl)amino]ethanol |
| PubChem CID | 107478848 |
| Molecular Formula | C9H20F2N2O |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | 2-[5-aminopentyl(2,2-difluoroethyl)amino]ethanol |
| SMILES | NCCCCCN(CCO)CC(F)F |
| InChI | InChI=1S/C9H20F2N2O/c10-9(11)8-13(6-7-14)5-3-1-2-4-12/h9,14H,1-8,12H2 |
| InChIKey | DIFGGNQFHPLZFM-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[5-aminopentyl(2,2-difluoroethyl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-aminopentyl(2,2-difluoroethyl)amino]ethanol?
The IUPAC name of 2-[5-aminopentyl(2,2-difluoroethyl)amino]ethanol (CID 107478848) is 2-[5-aminopentyl(2,2-difluoroethyl)amino]ethanol.
What is the SMILES notation for 2-[5-aminopentyl(2,2-difluoroethyl)amino]ethanol?
The canonical SMILES for 2-[5-aminopentyl(2,2-difluoroethyl)amino]ethanol is NCCCCCN(CCO)CC(F)F.
What is the InChIKey of 2-[5-aminopentyl(2,2-difluoroethyl)amino]ethanol?
The InChIKey is DIFGGNQFHPLZFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20F2N2O/c10-9(11)8-13(6-7-14)5-3-1-2-4-12/h9,14H,1-8,12H2.
What are the key properties of 2-[5-aminopentyl(2,2-difluoroethyl)amino]ethanol?
2-[5-aminopentyl(2,2-difluoroethyl)amino]ethanol has a molecular weight of 210.27 g/mol, XLogP of 0.67, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-aminopentyl(2,2-difluoroethyl)amino]ethanol is sourced from PubChem (CID 107478848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).