C10H11Cl2F3N2O — CID 107479163
2-[(2,6-dichloro-3-pyridinyl)methyl-(2,2,2-trifluoroethyl)amino]ethanol (PubChem CID 107479163) has the molecular formula C10H11Cl2F3N2O and a molecular weight of 303.11 g/mol. Its IUPAC name is 2-[(2,6-dichloro-3-pyridinyl)methyl-(2,2,2-trifluoroethyl)amino]ethanol.
| Compound Name | 2-[(2,6-dichloro-3-pyridinyl)methyl-(2,2,2-trifluoroethyl)amino]ethanol |
|---|---|
| PubChem CID | 107479163 |
| Molecular Formula | C10H11Cl2F3N2O |
| Molecular Weight | 303.11 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | 2-[(2,6-dichloro-3-pyridinyl)methyl-(2,2,2-trifluoroethyl)amino]ethanol |
| SMILES | OCCN(Cc1ccc(Cl)nc1Cl)CC(F)(F)F |
| InChI | InChI=1S/C10H11Cl2F3N2O/c11-8-2-1-7(9(12)16-8)5-17(3-4-18)6-10(13,14)15/h1-2,18H,3-6H2 |
| InChIKey | APNCPKOTXXMWIE-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.11 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|