C11H10F4N2O4 — CID 107479182
N-(2,2-difluoroethyl)-2,6-difluoro-N-(2-hydroxyethyl)-3-nitrobenzamide (PubChem CID 107479182) has the molecular formula C11H10F4N2O4 and a molecular weight of 310.20 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-2,6-difluoro-N-(2-hydroxyethyl)-3-nitrobenzamide.
| Compound Name | N-(2,2-difluoroethyl)-2,6-difluoro-N-(2-hydroxyethyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 107479182 |
| Molecular Formula | C11H10F4N2O4 |
| Molecular Weight | 310.20 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | N-(2,2-difluoroethyl)-2,6-difluoro-N-(2-hydroxyethyl)-3-nitrobenzamide |
| SMILES | O=C(c1c(F)ccc([N+](=O)[O-])c1F)N(CCO)CC(F)F |
| InChI | InChI=1S/C11H10F4N2O4/c12-6-1-2-7(17(20)21)10(15)9(6)11(19)16(3-4-18)5-8(13)14/h1-2,8,18H,3-5H2 |
| InChIKey | MRHWEHHMZUPVHM-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.20 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|