About 3-chloro-4-[2,2-difluoroethyl(2-hydroxyethyl)amino]benzonitrile
3-chloro-4-[2,2-difluoroethyl(2-hydroxyethyl)amino]benzonitrile (PubChem CID 107479591) has the molecular formula C11H11ClF2N2O
and a molecular weight of 260.67 g/mol. Its IUPAC name is 3-chloro-4-[2,2-difluoroethyl(2-hydroxyethyl)amino]benzonitrile.
Molecular Properties
| Compound Name | 3-chloro-4-[2,2-difluoroethyl(2-hydroxyethyl)amino]benzonitrile |
| PubChem CID | 107479591 |
| Molecular Formula | C11H11ClF2N2O |
| Molecular Weight | 260.67 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 3-chloro-4-[2,2-difluoroethyl(2-hydroxyethyl)amino]benzonitrile |
| SMILES | N#Cc1ccc(N(CCO)CC(F)F)c(Cl)c1 |
| InChI | InChI=1S/C11H11ClF2N2O/c12-9-5-8(6-15)1-2-10(9)16(3-4-17)7-11(13)14/h1-2,5,11,17H,3-4,7H2 |
| InChIKey | YBYMMLVZQWQPEL-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.67 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-chloro-4-[2,2-difluoroethyl(2-hydroxyethyl)amino]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-4-[2,2-difluoroethyl(2-hydroxyethyl)amino]benzonitrile?
The IUPAC name of 3-chloro-4-[2,2-difluoroethyl(2-hydroxyethyl)amino]benzonitrile (CID 107479591) is 3-chloro-4-[2,2-difluoroethyl(2-hydroxyethyl)amino]benzonitrile.
What is the SMILES notation for 3-chloro-4-[2,2-difluoroethyl(2-hydroxyethyl)amino]benzonitrile?
The canonical SMILES for 3-chloro-4-[2,2-difluoroethyl(2-hydroxyethyl)amino]benzonitrile is N#Cc1ccc(N(CCO)CC(F)F)c(Cl)c1.
What is the InChIKey of 3-chloro-4-[2,2-difluoroethyl(2-hydroxyethyl)amino]benzonitrile?
The InChIKey is YBYMMLVZQWQPEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11ClF2N2O/c12-9-5-8(6-15)1-2-10(9)16(3-4-17)7-11(13)14/h1-2,5,11,17H,3-4,7H2.
What are the key properties of 3-chloro-4-[2,2-difluoroethyl(2-hydroxyethyl)amino]benzonitrile?
3-chloro-4-[2,2-difluoroethyl(2-hydroxyethyl)amino]benzonitrile has a molecular weight of 260.67 g/mol, XLogP of 2.28, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4-[2,2-difluoroethyl(2-hydroxyethyl)amino]benzonitrile is sourced from PubChem (CID 107479591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).