About 3-[2,2-difluoroethyl(2-hydroxyethyl)amino]butanenitrile
3-[2,2-difluoroethyl(2-hydroxyethyl)amino]butanenitrile (PubChem CID 107479665) has the molecular formula C8H14F2N2O
and a molecular weight of 192.21 g/mol. Its IUPAC name is 3-[2,2-difluoroethyl(2-hydroxyethyl)amino]butanenitrile.
Molecular Properties
| Compound Name | 3-[2,2-difluoroethyl(2-hydroxyethyl)amino]butanenitrile |
| PubChem CID | 107479665 |
| Molecular Formula | C8H14F2N2O |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | 3-[2,2-difluoroethyl(2-hydroxyethyl)amino]butanenitrile |
| SMILES | CC(CC#N)N(CCO)CC(F)F |
| InChI | InChI=1S/C8H14F2N2O/c1-7(2-3-11)12(4-5-13)6-8(9)10/h7-8,13H,2,4-6H2,1H3 |
| InChIKey | PPZQMMXIYKUUFZ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[2,2-difluoroethyl(2-hydroxyethyl)amino]butanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2,2-difluoroethyl(2-hydroxyethyl)amino]butanenitrile?
The IUPAC name of 3-[2,2-difluoroethyl(2-hydroxyethyl)amino]butanenitrile (CID 107479665) is 3-[2,2-difluoroethyl(2-hydroxyethyl)amino]butanenitrile.
What is the SMILES notation for 3-[2,2-difluoroethyl(2-hydroxyethyl)amino]butanenitrile?
The canonical SMILES for 3-[2,2-difluoroethyl(2-hydroxyethyl)amino]butanenitrile is CC(CC#N)N(CCO)CC(F)F.
What is the InChIKey of 3-[2,2-difluoroethyl(2-hydroxyethyl)amino]butanenitrile?
The InChIKey is PPZQMMXIYKUUFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14F2N2O/c1-7(2-3-11)12(4-5-13)6-8(9)10/h7-8,13H,2,4-6H2,1H3.
What are the key properties of 3-[2,2-difluoroethyl(2-hydroxyethyl)amino]butanenitrile?
3-[2,2-difluoroethyl(2-hydroxyethyl)amino]butanenitrile has a molecular weight of 192.21 g/mol, XLogP of 0.85, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2,2-difluoroethyl(2-hydroxyethyl)amino]butanenitrile is sourced from PubChem (CID 107479665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).