About 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2,2-dimethylbutanenitrile
4-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2,2-dimethylbutanenitrile (PubChem CID 107479674) has the molecular formula C10H18F2N2O
and a molecular weight of 220.26 g/mol. Its IUPAC name is 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2,2-dimethylbutanenitrile.
Molecular Properties
| Compound Name | 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2,2-dimethylbutanenitrile |
| PubChem CID | 107479674 |
| Molecular Formula | C10H18F2N2O |
| Molecular Weight | 220.26 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2,2-dimethylbutanenitrile |
| SMILES | CC(C)(C#N)CCN(CCO)CC(F)F |
| InChI | InChI=1S/C10H18F2N2O/c1-10(2,8-13)3-4-14(5-6-15)7-9(11)12/h9,15H,3-7H2,1-2H3 |
| InChIKey | CANLSKABMWXOBY-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.26 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2,2-dimethylbutanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2,2-dimethylbutanenitrile?
The IUPAC name of 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2,2-dimethylbutanenitrile (CID 107479674) is 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2,2-dimethylbutanenitrile.
What is the SMILES notation for 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2,2-dimethylbutanenitrile?
The canonical SMILES for 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2,2-dimethylbutanenitrile is CC(C)(C#N)CCN(CCO)CC(F)F.
What is the InChIKey of 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2,2-dimethylbutanenitrile?
The InChIKey is CANLSKABMWXOBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18F2N2O/c1-10(2,8-13)3-4-14(5-6-15)7-9(11)12/h9,15H,3-7H2,1-2H3.
What are the key properties of 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2,2-dimethylbutanenitrile?
4-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2,2-dimethylbutanenitrile has a molecular weight of 220.26 g/mol, XLogP of 1.49, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2,2-dimethylbutanenitrile is sourced from PubChem (CID 107479674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).