About 5-[2,2-difluoroethyl(2-hydroxyethyl)amino]pentanenitrile
5-[2,2-difluoroethyl(2-hydroxyethyl)amino]pentanenitrile (PubChem CID 107479682) has the molecular formula C9H16F2N2O
and a molecular weight of 206.24 g/mol. Its IUPAC name is 5-[2,2-difluoroethyl(2-hydroxyethyl)amino]pentanenitrile.
Molecular Properties
| Compound Name | 5-[2,2-difluoroethyl(2-hydroxyethyl)amino]pentanenitrile |
| PubChem CID | 107479682 |
| Molecular Formula | C9H16F2N2O |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 5-[2,2-difluoroethyl(2-hydroxyethyl)amino]pentanenitrile |
| SMILES | N#CCCCCN(CCO)CC(F)F |
| InChI | InChI=1S/C9H16F2N2O/c10-9(11)8-13(6-7-14)5-3-1-2-4-12/h9,14H,1-3,5-8H2 |
| InChIKey | IRQIOVDJIKTCGA-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[2,2-difluoroethyl(2-hydroxyethyl)amino]pentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2,2-difluoroethyl(2-hydroxyethyl)amino]pentanenitrile?
The IUPAC name of 5-[2,2-difluoroethyl(2-hydroxyethyl)amino]pentanenitrile (CID 107479682) is 5-[2,2-difluoroethyl(2-hydroxyethyl)amino]pentanenitrile.
What is the SMILES notation for 5-[2,2-difluoroethyl(2-hydroxyethyl)amino]pentanenitrile?
The canonical SMILES for 5-[2,2-difluoroethyl(2-hydroxyethyl)amino]pentanenitrile is N#CCCCCN(CCO)CC(F)F.
What is the InChIKey of 5-[2,2-difluoroethyl(2-hydroxyethyl)amino]pentanenitrile?
The InChIKey is IRQIOVDJIKTCGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F2N2O/c10-9(11)8-13(6-7-14)5-3-1-2-4-12/h9,14H,1-3,5-8H2.
What are the key properties of 5-[2,2-difluoroethyl(2-hydroxyethyl)amino]pentanenitrile?
5-[2,2-difluoroethyl(2-hydroxyethyl)amino]pentanenitrile has a molecular weight of 206.24 g/mol, XLogP of 1.24, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2,2-difluoroethyl(2-hydroxyethyl)amino]pentanenitrile is sourced from PubChem (CID 107479682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).