About 5-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2,2-dimethylpentanenitrile
5-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2,2-dimethylpentanenitrile (PubChem CID 107479696) has the molecular formula C11H20F2N2O
and a molecular weight of 234.29 g/mol. Its IUPAC name is 5-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2,2-dimethylpentanenitrile.
Molecular Properties
| Compound Name | 5-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2,2-dimethylpentanenitrile |
| PubChem CID | 107479696 |
| Molecular Formula | C11H20F2N2O |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 5-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2,2-dimethylpentanenitrile |
| SMILES | CC(C)(C#N)CCCN(CCO)CC(F)F |
| InChI | InChI=1S/C11H20F2N2O/c1-11(2,9-14)4-3-5-15(6-7-16)8-10(12)13/h10,16H,3-8H2,1-2H3 |
| InChIKey | ZLKPFUCZWLXBCY-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2,2-dimethylpentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2,2-dimethylpentanenitrile?
The IUPAC name of 5-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2,2-dimethylpentanenitrile (CID 107479696) is 5-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2,2-dimethylpentanenitrile.
What is the SMILES notation for 5-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2,2-dimethylpentanenitrile?
The canonical SMILES for 5-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2,2-dimethylpentanenitrile is CC(C)(C#N)CCCN(CCO)CC(F)F.
What is the InChIKey of 5-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2,2-dimethylpentanenitrile?
The InChIKey is ZLKPFUCZWLXBCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20F2N2O/c1-11(2,9-14)4-3-5-15(6-7-16)8-10(12)13/h10,16H,3-8H2,1-2H3.
What are the key properties of 5-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2,2-dimethylpentanenitrile?
5-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2,2-dimethylpentanenitrile has a molecular weight of 234.29 g/mol, XLogP of 1.88, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2,2-dimethylpentanenitrile is sourced from PubChem (CID 107479696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).