C11H17F3N2O2S — CID 107479776
1-carbamothioyl-N-(2-hydroxyethyl)-3-methyl-N-(2,2,2-trifluoroethyl)cyclobutane-1-carboxamide (PubChem CID 107479776) has the molecular formula C11H17F3N2O2S and a molecular weight of 298.33 g/mol. Its IUPAC name is 1-carbamothioyl-N-(2-hydroxyethyl)-3-methyl-N-(2,2,2-trifluoroethyl)cyclobutane-1-carboxamide.
| Compound Name | 1-carbamothioyl-N-(2-hydroxyethyl)-3-methyl-N-(2,2,2-trifluoroethyl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 107479776 |
| Molecular Formula | C11H17F3N2O2S |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 1-carbamothioyl-N-(2-hydroxyethyl)-3-methyl-N-(2,2,2-trifluoroethyl)cyclobutane-1-carboxamide |
| SMILES | CC1CC(C(=O)N(CCO)CC(F)(F)F)(C(N)=S)C1 |
| InChI | InChI=1S/C11H17F3N2O2S/c1-7-4-10(5-7,8(15)19)9(18)16(2-3-17)6-11(12,13)14/h7,17H,2-6H2,1H3,(H2,15,19) |
| InChIKey | ZKNMKWDPSBXWBP-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|