C12H17F2N3OS — CID 107479851
4-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2,6-dimethylpyridine-3-carbothioamide (PubChem CID 107479851) has the molecular formula C12H17F2N3OS and a molecular weight of 289.35 g/mol. Its IUPAC name is 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2,6-dimethylpyridine-3-carbothioamide.
| Compound Name | 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2,6-dimethylpyridine-3-carbothioamide |
|---|---|
| PubChem CID | 107479851 |
| Molecular Formula | C12H17F2N3OS |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2,6-dimethylpyridine-3-carbothioamide |
| SMILES | Cc1cc(N(CCO)CC(F)F)c(C(N)=S)c(C)n1 |
| InChI | InChI=1S/C12H17F2N3OS/c1-7-5-9(11(12(15)19)8(2)16-7)17(3-4-18)6-10(13)14/h5,10,18H,3-4,6H2,1-2H3,(H2,15,19) |
| InChIKey | DXFNZMIGOXJLNH-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 62.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|