C11H15F3N4OS — CID 107479876
3-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]-5,6-dimethylpyridazine-4-carbothioamide (PubChem CID 107479876) has the molecular formula C11H15F3N4OS and a molecular weight of 308.33 g/mol. Its IUPAC name is 3-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]-5,6-dimethylpyridazine-4-carbothioamide.
| Compound Name | 3-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]-5,6-dimethylpyridazine-4-carbothioamide |
|---|---|
| PubChem CID | 107479876 |
| Molecular Formula | C11H15F3N4OS |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 3-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]-5,6-dimethylpyridazine-4-carbothioamide |
| SMILES | Cc1nnc(N(CCO)CC(F)(F)F)c(C(N)=S)c1C |
| InChI | InChI=1S/C11H15F3N4OS/c1-6-7(2)16-17-10(8(6)9(15)20)18(3-4-19)5-11(12,13)14/h19H,3-5H2,1-2H3,(H2,15,20) |
| InChIKey | POYAPUKLZYOUQY-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|