C12H16F3N3OS — CID 107479885
4-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]-2,6-dimethylpyridine-3-carbothioamide (PubChem CID 107479885) has the molecular formula C12H16F3N3OS and a molecular weight of 307.34 g/mol. Its IUPAC name is 4-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]-2,6-dimethylpyridine-3-carbothioamide.
| Compound Name | 4-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]-2,6-dimethylpyridine-3-carbothioamide |
|---|---|
| PubChem CID | 107479885 |
| Molecular Formula | C12H16F3N3OS |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 4-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]-2,6-dimethylpyridine-3-carbothioamide |
| SMILES | Cc1cc(N(CCO)CC(F)(F)F)c(C(N)=S)c(C)n1 |
| InChI | InChI=1S/C12H16F3N3OS/c1-7-5-9(10(11(16)20)8(2)17-7)18(3-4-19)6-12(13,14)15/h5,19H,3-4,6H2,1-2H3,(H2,16,20) |
| InChIKey | ZATJVWXLHSEUHN-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 62.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|