About 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]butanethioamide
4-[2,2-difluoroethyl(2-hydroxyethyl)amino]butanethioamide (PubChem CID 107479930) has the molecular formula C8H16F2N2OS
and a molecular weight of 226.29 g/mol. Its IUPAC name is 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]butanethioamide.
Molecular Properties
| Compound Name | 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]butanethioamide |
| PubChem CID | 107479930 |
| Molecular Formula | C8H16F2N2OS |
| Molecular Weight | 226.29 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]butanethioamide |
| SMILES | NC(=S)CCCN(CCO)CC(F)F |
| InChI | InChI=1S/C8H16F2N2OS/c9-7(10)6-12(4-5-13)3-1-2-8(11)14/h7,13H,1-6H2,(H2,11,14) |
| InChIKey | ZJHZAYYQBWITOQ-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.29 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]butanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]butanethioamide?
The IUPAC name of 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]butanethioamide (CID 107479930) is 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]butanethioamide.
What is the SMILES notation for 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]butanethioamide?
The canonical SMILES for 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]butanethioamide is NC(=S)CCCN(CCO)CC(F)F.
What is the InChIKey of 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]butanethioamide?
The InChIKey is ZJHZAYYQBWITOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16F2N2OS/c9-7(10)6-12(4-5-13)3-1-2-8(11)14/h7,13H,1-6H2,(H2,11,14).
What are the key properties of 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]butanethioamide?
4-[2,2-difluoroethyl(2-hydroxyethyl)amino]butanethioamide has a molecular weight of 226.29 g/mol, XLogP of 0.61, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]butanethioamide is sourced from PubChem (CID 107479930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).