About 4-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]butanethioamide
4-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]butanethioamide (PubChem CID 107479967) has the molecular formula C8H15F3N2OS
and a molecular weight of 244.28 g/mol. Its IUPAC name is 4-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]butanethioamide.
Molecular Properties
| Compound Name | 4-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]butanethioamide |
| PubChem CID | 107479967 |
| Molecular Formula | C8H15F3N2OS |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | 4-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]butanethioamide |
| SMILES | NC(=S)CCCN(CCO)CC(F)(F)F |
| InChI | InChI=1S/C8H15F3N2OS/c9-8(10,11)6-13(4-5-14)3-1-2-7(12)15/h14H,1-6H2,(H2,12,15) |
| InChIKey | NWFLJUVRVORCAQ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]butanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]butanethioamide?
The IUPAC name of 4-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]butanethioamide (CID 107479967) is 4-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]butanethioamide.
What is the SMILES notation for 4-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]butanethioamide?
The canonical SMILES for 4-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]butanethioamide is NC(=S)CCCN(CCO)CC(F)(F)F.
What is the InChIKey of 4-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]butanethioamide?
The InChIKey is NWFLJUVRVORCAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15F3N2OS/c9-8(10,11)6-13(4-5-14)3-1-2-7(12)15/h14H,1-6H2,(H2,12,15).
What are the key properties of 4-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]butanethioamide?
4-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]butanethioamide has a molecular weight of 244.28 g/mol, XLogP of 0.91, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]butanethioamide is sourced from PubChem (CID 107479967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).