About 5-bromo-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)thiophene-2-carboxamide
5-bromo-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)thiophene-2-carboxamide (PubChem CID 107479988) has the molecular formula C9H10BrF2NO2S
and a molecular weight of 314.15 g/mol. Its IUPAC name is 5-bromo-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)thiophene-2-carboxamide.
Molecular Properties
| Compound Name | 5-bromo-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)thiophene-2-carboxamide |
| PubChem CID | 107479988 |
| Molecular Formula | C9H10BrF2NO2S |
| Molecular Weight | 314.15 g/mol |
| Exact Mass | 312.96 |
| IUPAC Name | 5-bromo-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)thiophene-2-carboxamide |
| SMILES | O=C(c1ccc(Br)s1)N(CCO)CC(F)F |
| InChI | InChI=1S/C9H10BrF2NO2S/c10-7-2-1-6(16-7)9(15)13(3-4-14)5-8(11)12/h1-2,8,14H,3-5H2 |
| InChIKey | QNSLOXJOXOCHDT-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.15 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-bromo-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)thiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)thiophene-2-carboxamide?
The IUPAC name of 5-bromo-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)thiophene-2-carboxamide (CID 107479988) is 5-bromo-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)thiophene-2-carboxamide.
What is the SMILES notation for 5-bromo-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)thiophene-2-carboxamide?
The canonical SMILES for 5-bromo-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)thiophene-2-carboxamide is O=C(c1ccc(Br)s1)N(CCO)CC(F)F.
What is the InChIKey of 5-bromo-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)thiophene-2-carboxamide?
The InChIKey is QNSLOXJOXOCHDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10BrF2NO2S/c10-7-2-1-6(16-7)9(15)13(3-4-14)5-8(11)12/h1-2,8,14H,3-5H2.
What are the key properties of 5-bromo-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)thiophene-2-carboxamide?
5-bromo-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)thiophene-2-carboxamide has a molecular weight of 314.15 g/mol, XLogP of 2.21, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)thiophene-2-carboxamide is sourced from PubChem (CID 107479988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).