C13H18F2N4O2 — CID 107480078
2-[2,2-difluoroethyl(2-hydroxyethyl)amino]-N'-hydroxy-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboximidamide (PubChem CID 107480078) has the molecular formula C13H18F2N4O2 and a molecular weight of 300.31 g/mol. Its IUPAC name is 2-[2,2-difluoroethyl(2-hydroxyethyl)amino]-N'-hydroxy-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboximidamide.
| Compound Name | 2-[2,2-difluoroethyl(2-hydroxyethyl)amino]-N'-hydroxy-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 107480078 |
| Molecular Formula | C13H18F2N4O2 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 2-[2,2-difluoroethyl(2-hydroxyethyl)amino]-N'-hydroxy-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboximidamide |
| SMILES | N/C(=N/O)c1cc2c(nc1N(CCO)CC(F)F)CCC2 |
| InChI | InChI=1S/C13H18F2N4O2/c14-11(15)7-19(4-5-20)13-9(12(16)18-21)6-8-2-1-3-10(8)17-13/h6,11,20-21H,1-5,7H2,(H2,16,18) |
| InChIKey | ROPLSBAEFUSCRQ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 94.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|