About 2-chloro-N'-hydroxy-6-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]benzenecarboximidamide
2-chloro-N'-hydroxy-6-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]benzenecarboximidamide (PubChem CID 107480091) has the molecular formula C11H13ClF3N3O2
and a molecular weight of 311.69 g/mol. Its IUPAC name is 2-chloro-N'-hydroxy-6-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]benzenecarboximidamide.
Molecular Properties
| Compound Name | 2-chloro-N'-hydroxy-6-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]benzenecarboximidamide |
| PubChem CID | 107480091 |
| Molecular Formula | C11H13ClF3N3O2 |
| Molecular Weight | 311.69 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 2-chloro-N'-hydroxy-6-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]benzenecarboximidamide |
| SMILES | N/C(=N/O)c1c(Cl)cccc1N(CCO)CC(F)(F)F |
| InChI | InChI=1S/C11H13ClF3N3O2/c12-7-2-1-3-8(9(7)10(16)17-20)18(4-5-19)6-11(13,14)15/h1-3,19-20H,4-6H2,(H2,16,17) |
| InChIKey | JQZMJHKXYFAVRF-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.69 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N'-hydroxy-6-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]benzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N'-hydroxy-6-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]benzenecarboximidamide?
The IUPAC name of 2-chloro-N'-hydroxy-6-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]benzenecarboximidamide (CID 107480091) is 2-chloro-N'-hydroxy-6-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]benzenecarboximidamide.
What is the SMILES notation for 2-chloro-N'-hydroxy-6-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]benzenecarboximidamide?
The canonical SMILES for 2-chloro-N'-hydroxy-6-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]benzenecarboximidamide is N/C(=N/O)c1c(Cl)cccc1N(CCO)CC(F)(F)F.
What is the InChIKey of 2-chloro-N'-hydroxy-6-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]benzenecarboximidamide?
The InChIKey is JQZMJHKXYFAVRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClF3N3O2/c12-7-2-1-3-8(9(7)10(16)17-20)18(4-5-19)6-11(13,14)15/h1-3,19-20H,4-6H2,(H2,16,17).
What are the key properties of 2-chloro-N'-hydroxy-6-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]benzenecarboximidamide?
2-chloro-N'-hydroxy-6-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]benzenecarboximidamide has a molecular weight of 311.69 g/mol, XLogP of 1.80, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N'-hydroxy-6-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]benzenecarboximidamide is sourced from PubChem (CID 107480091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).