C9H19F2N3O2 — CID 107480137
5-[2,2-difluoroethyl(2-hydroxyethyl)amino]-N'-hydroxypentanimidamide (PubChem CID 107480137) has the molecular formula C9H19F2N3O2 and a molecular weight of 239.27 g/mol. Its IUPAC name is 5-[2,2-difluoroethyl(2-hydroxyethyl)amino]-N'-hydroxypentanimidamide.
| Compound Name | 5-[2,2-difluoroethyl(2-hydroxyethyl)amino]-N'-hydroxypentanimidamide |
|---|---|
| PubChem CID | 107480137 |
| Molecular Formula | C9H19F2N3O2 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 5-[2,2-difluoroethyl(2-hydroxyethyl)amino]-N'-hydroxypentanimidamide |
| SMILES | NC(CCCCN(CCO)CC(F)F)=NO |
| InChI | InChI=1S/C9H19F2N3O2/c10-8(11)7-14(5-6-15)4-2-1-3-9(12)13-16/h8,15-16H,1-7H2,(H2,12,13) |
| InChIKey | ZYDKTDMOIZRZLT-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|