C7H15F2N3O2 — CID 107480143
3-[2,2-difluoroethyl(2-hydroxyethyl)amino]-N'-hydroxypropanimidamide (PubChem CID 107480143) has the molecular formula C7H15F2N3O2 and a molecular weight of 211.21 g/mol. Its IUPAC name is 3-[2,2-difluoroethyl(2-hydroxyethyl)amino]-N'-hydroxypropanimidamide.
| Compound Name | 3-[2,2-difluoroethyl(2-hydroxyethyl)amino]-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 107480143 |
| Molecular Formula | C7H15F2N3O2 |
| Molecular Weight | 211.21 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 3-[2,2-difluoroethyl(2-hydroxyethyl)amino]-N'-hydroxypropanimidamide |
| SMILES | NC(CCN(CCO)CC(F)F)=NO |
| InChI | InChI=1S/C7H15F2N3O2/c8-6(9)5-12(3-4-13)2-1-7(10)11-14/h6,13-14H,1-5H2,(H2,10,11) |
| InChIKey | ZTHYEUXZOFBCIF-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.21 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|