C8H17F2N3O2 — CID 107480149
2-[2,2-difluoroethyl(2-hydroxyethyl)amino]-N'-hydroxybutanimidamide (PubChem CID 107480149) has the molecular formula C8H17F2N3O2 and a molecular weight of 225.24 g/mol. Its IUPAC name is 2-[2,2-difluoroethyl(2-hydroxyethyl)amino]-N'-hydroxybutanimidamide.
| Compound Name | 2-[2,2-difluoroethyl(2-hydroxyethyl)amino]-N'-hydroxybutanimidamide |
|---|---|
| PubChem CID | 107480149 |
| Molecular Formula | C8H17F2N3O2 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 2-[2,2-difluoroethyl(2-hydroxyethyl)amino]-N'-hydroxybutanimidamide |
| SMILES | CCC(C(N)=NO)N(CCO)CC(F)F |
| InChI | InChI=1S/C8H17F2N3O2/c1-2-6(8(11)12-15)13(3-4-14)5-7(9)10/h6-7,14-15H,2-5H2,1H3,(H2,11,12) |
| InChIKey | FZBZQTLNXAPFNF-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|