About 2-[2,2-difluoroethyl(2-hydroxyethyl)amino]-N'-hydroxypropanimidamide
2-[2,2-difluoroethyl(2-hydroxyethyl)amino]-N'-hydroxypropanimidamide (PubChem CID 107480156) has the molecular formula C7H15F2N3O2
and a molecular weight of 211.21 g/mol. Its IUPAC name is 2-[2,2-difluoroethyl(2-hydroxyethyl)amino]-N'-hydroxypropanimidamide.
Molecular Properties
| Compound Name | 2-[2,2-difluoroethyl(2-hydroxyethyl)amino]-N'-hydroxypropanimidamide |
| PubChem CID | 107480156 |
| Molecular Formula | C7H15F2N3O2 |
| Molecular Weight | 211.21 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 2-[2,2-difluoroethyl(2-hydroxyethyl)amino]-N'-hydroxypropanimidamide |
| SMILES | CC(C(N)=NO)N(CCO)CC(F)F |
| InChI | InChI=1S/C7H15F2N3O2/c1-5(7(10)11-14)12(2-3-13)4-6(8)9/h5-6,13-14H,2-4H2,1H3,(H2,10,11) |
| InChIKey | YIWJPSQRMJLXME-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.21 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[2,2-difluoroethyl(2-hydroxyethyl)amino]-N'-hydroxypropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,2-difluoroethyl(2-hydroxyethyl)amino]-N'-hydroxypropanimidamide?
The IUPAC name of 2-[2,2-difluoroethyl(2-hydroxyethyl)amino]-N'-hydroxypropanimidamide (CID 107480156) is 2-[2,2-difluoroethyl(2-hydroxyethyl)amino]-N'-hydroxypropanimidamide.
What is the SMILES notation for 2-[2,2-difluoroethyl(2-hydroxyethyl)amino]-N'-hydroxypropanimidamide?
The canonical SMILES for 2-[2,2-difluoroethyl(2-hydroxyethyl)amino]-N'-hydroxypropanimidamide is CC(C(N)=NO)N(CCO)CC(F)F.
What is the InChIKey of 2-[2,2-difluoroethyl(2-hydroxyethyl)amino]-N'-hydroxypropanimidamide?
The InChIKey is YIWJPSQRMJLXME-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15F2N3O2/c1-5(7(10)11-14)12(2-3-13)4-6(8)9/h5-6,13-14H,2-4H2,1H3,(H2,10,11).
What are the key properties of 2-[2,2-difluoroethyl(2-hydroxyethyl)amino]-N'-hydroxypropanimidamide?
2-[2,2-difluoroethyl(2-hydroxyethyl)amino]-N'-hydroxypropanimidamide has a molecular weight of 211.21 g/mol, XLogP of -0.32, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,2-difluoroethyl(2-hydroxyethyl)amino]-N'-hydroxypropanimidamide is sourced from PubChem (CID 107480156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).