C8H13F6N3O2 — CID 107480162
3,3,3-trifluoro-N'-hydroxy-2-[[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]methyl]propanimidamide (PubChem CID 107480162) has the molecular formula C8H13F6N3O2 and a molecular weight of 297.20 g/mol. Its IUPAC name is 3,3,3-trifluoro-N'-hydroxy-2-[[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]methyl]propanimidamide.
| Compound Name | 3,3,3-trifluoro-N'-hydroxy-2-[[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]methyl]propanimidamide |
|---|---|
| PubChem CID | 107480162 |
| Molecular Formula | C8H13F6N3O2 |
| Molecular Weight | 297.20 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 3,3,3-trifluoro-N'-hydroxy-2-[[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]methyl]propanimidamide |
| SMILES | NC(=NO)C(CN(CCO)CC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H13F6N3O2/c9-7(10,11)4-17(1-2-18)3-5(6(15)16-19)8(12,13)14/h5,18-19H,1-4H2,(H2,15,16) |
| InChIKey | ZHTOQGTXZYXZMT-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.20 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|