About 2-[2,2-difluoroethyl(2-hydroxyethyl)amino]-6-methylsulfanylbenzenecarboximidamide
2-[2,2-difluoroethyl(2-hydroxyethyl)amino]-6-methylsulfanylbenzenecarboximidamide (PubChem CID 107480209) has the molecular formula C12H17F2N3OS
and a molecular weight of 289.35 g/mol. Its IUPAC name is 2-[2,2-difluoroethyl(2-hydroxyethyl)amino]-6-methylsulfanylbenzenecarboximidamide.
Molecular Properties
| Compound Name | 2-[2,2-difluoroethyl(2-hydroxyethyl)amino]-6-methylsulfanylbenzenecarboximidamide |
| PubChem CID | 107480209 |
| Molecular Formula | C12H17F2N3OS |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 2-[2,2-difluoroethyl(2-hydroxyethyl)amino]-6-methylsulfanylbenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1c(SC)cccc1N(CCO)CC(F)F |
| InChI | InChI=1S/C12H17F2N3OS/c1-19-9-4-2-3-8(11(9)12(15)16)17(5-6-18)7-10(13)14/h2-4,10,18H,5-7H2,1H3,(H3,15,16) |
| InChIKey | SGZSCOAXWWGMSD-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[2,2-difluoroethyl(2-hydroxyethyl)amino]-6-methylsulfanylbenzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,2-difluoroethyl(2-hydroxyethyl)amino]-6-methylsulfanylbenzenecarboximidamide?
The IUPAC name of 2-[2,2-difluoroethyl(2-hydroxyethyl)amino]-6-methylsulfanylbenzenecarboximidamide (CID 107480209) is 2-[2,2-difluoroethyl(2-hydroxyethyl)amino]-6-methylsulfanylbenzenecarboximidamide.
What is the SMILES notation for 2-[2,2-difluoroethyl(2-hydroxyethyl)amino]-6-methylsulfanylbenzenecarboximidamide?
The canonical SMILES for 2-[2,2-difluoroethyl(2-hydroxyethyl)amino]-6-methylsulfanylbenzenecarboximidamide is [H]/N=C(\N)c1c(SC)cccc1N(CCO)CC(F)F.
What is the InChIKey of 2-[2,2-difluoroethyl(2-hydroxyethyl)amino]-6-methylsulfanylbenzenecarboximidamide?
The InChIKey is SGZSCOAXWWGMSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17F2N3OS/c1-19-9-4-2-3-8(11(9)12(15)16)17(5-6-18)7-10(13)14/h2-4,10,18H,5-7H2,1H3,(H3,15,16).
What are the key properties of 2-[2,2-difluoroethyl(2-hydroxyethyl)amino]-6-methylsulfanylbenzenecarboximidamide?
2-[2,2-difluoroethyl(2-hydroxyethyl)amino]-6-methylsulfanylbenzenecarboximidamide has a molecular weight of 289.35 g/mol, XLogP of 1.76, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,2-difluoroethyl(2-hydroxyethyl)amino]-6-methylsulfanylbenzenecarboximidamide is sourced from PubChem (CID 107480209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).