C13H18F3N3OS — CID 107480227
2-ethylsulfanyl-6-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]benzenecarboximidamide (PubChem CID 107480227) has the molecular formula C13H18F3N3OS and a molecular weight of 321.37 g/mol. Its IUPAC name is 2-ethylsulfanyl-6-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]benzenecarboximidamide.
| Compound Name | 2-ethylsulfanyl-6-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 107480227 |
| Molecular Formula | C13H18F3N3OS |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 2-ethylsulfanyl-6-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1c(SCC)cccc1N(CCO)CC(F)(F)F |
| InChI | InChI=1S/C13H18F3N3OS/c1-2-21-10-5-3-4-9(11(10)12(17)18)19(6-7-20)8-13(14,15)16/h3-5,20H,2,6-8H2,1H3,(H3,17,18) |
| InChIKey | OVQKSTOSBUMQIF-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|