C12H16F3N3OS — CID 107480243
2-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]-6-methylsulfanylbenzenecarboximidamide (PubChem CID 107480243) has the molecular formula C12H16F3N3OS and a molecular weight of 307.34 g/mol. Its IUPAC name is 2-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]-6-methylsulfanylbenzenecarboximidamide.
| Compound Name | 2-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]-6-methylsulfanylbenzenecarboximidamide |
|---|---|
| PubChem CID | 107480243 |
| Molecular Formula | C12H16F3N3OS |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 2-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]-6-methylsulfanylbenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1c(SC)cccc1N(CCO)CC(F)(F)F |
| InChI | InChI=1S/C12H16F3N3OS/c1-20-9-4-2-3-8(10(9)11(16)17)18(5-6-19)7-12(13,14)15/h2-4,19H,5-7H2,1H3,(H3,16,17) |
| InChIKey | UNOMHGMXMHRHAY-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|