About 3-[2,2-difluoroethyl(2-hydroxyethyl)amino]propanimidamide
3-[2,2-difluoroethyl(2-hydroxyethyl)amino]propanimidamide (PubChem CID 107480270) has the molecular formula C7H15F2N3O
and a molecular weight of 195.21 g/mol. Its IUPAC name is 3-[2,2-difluoroethyl(2-hydroxyethyl)amino]propanimidamide.
Molecular Properties
| Compound Name | 3-[2,2-difluoroethyl(2-hydroxyethyl)amino]propanimidamide |
| PubChem CID | 107480270 |
| Molecular Formula | C7H15F2N3O |
| Molecular Weight | 195.21 g/mol |
| Exact Mass | 195.12 |
| IUPAC Name | 3-[2,2-difluoroethyl(2-hydroxyethyl)amino]propanimidamide |
| SMILES | [H]/N=C(\N)CCN(CCO)CC(F)F |
| InChI | InChI=1S/C7H15F2N3O/c8-6(9)5-12(3-4-13)2-1-7(10)11/h6,13H,1-5H2,(H3,10,11) |
| InChIKey | NBZMGJBTNVEVCS-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.21 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[2,2-difluoroethyl(2-hydroxyethyl)amino]propanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2,2-difluoroethyl(2-hydroxyethyl)amino]propanimidamide?
The IUPAC name of 3-[2,2-difluoroethyl(2-hydroxyethyl)amino]propanimidamide (CID 107480270) is 3-[2,2-difluoroethyl(2-hydroxyethyl)amino]propanimidamide.
What is the SMILES notation for 3-[2,2-difluoroethyl(2-hydroxyethyl)amino]propanimidamide?
The canonical SMILES for 3-[2,2-difluoroethyl(2-hydroxyethyl)amino]propanimidamide is [H]/N=C(\N)CCN(CCO)CC(F)F.
What is the InChIKey of 3-[2,2-difluoroethyl(2-hydroxyethyl)amino]propanimidamide?
The InChIKey is NBZMGJBTNVEVCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15F2N3O/c8-6(9)5-12(3-4-13)2-1-7(10)11/h6,13H,1-5H2,(H3,10,11).
What are the key properties of 3-[2,2-difluoroethyl(2-hydroxyethyl)amino]propanimidamide?
3-[2,2-difluoroethyl(2-hydroxyethyl)amino]propanimidamide has a molecular weight of 195.21 g/mol, XLogP of -0.13, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2,2-difluoroethyl(2-hydroxyethyl)amino]propanimidamide is sourced from PubChem (CID 107480270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).