C12H15F4N3O — CID 107480310
5-fluoro-2-[[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]methyl]benzenecarboximidamide (PubChem CID 107480310) has the molecular formula C12H15F4N3O and a molecular weight of 293.26 g/mol. Its IUPAC name is 5-fluoro-2-[[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]methyl]benzenecarboximidamide.
| Compound Name | 5-fluoro-2-[[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 107480310 |
| Molecular Formula | C12H15F4N3O |
| Molecular Weight | 293.26 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 5-fluoro-2-[[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]methyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cc(F)ccc1CN(CCO)CC(F)(F)F |
| InChI | InChI=1S/C12H15F4N3O/c13-9-2-1-8(10(5-9)11(17)18)6-19(3-4-20)7-12(14,15)16/h1-2,5,20H,3-4,6-7H2,(H3,17,18) |
| InChIKey | AEEMVQTXVVGKFV-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.26 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|