C9H13F2N5O3S2 — CID 107480742
N-(2,2-difluoroethyl)-6-hydrazinyl-N-(2-hydroxyethyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide (PubChem CID 107480742) has the molecular formula C9H13F2N5O3S2 and a molecular weight of 341.37 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-6-hydrazinyl-N-(2-hydroxyethyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide.
| Compound Name | N-(2,2-difluoroethyl)-6-hydrazinyl-N-(2-hydroxyethyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 107480742 |
| Molecular Formula | C9H13F2N5O3S2 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | N-(2,2-difluoroethyl)-6-hydrazinyl-N-(2-hydroxyethyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide |
| SMILES | NNc1nc2sccn2c1S(=O)(=O)N(CCO)CC(F)F |
| InChI | InChI=1S/C9H13F2N5O3S2/c10-6(11)5-15(1-3-17)21(18,19)8-7(14-12)13-9-16(8)2-4-20-9/h2,4,6,14,17H,1,3,5,12H2 |
| InChIKey | LWFBBVJYYXKMBT-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 112.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|