About 5-bromo-N-(2,2-difluoroethyl)-2-hydrazinyl-N-(2-hydroxyethyl)pyridine-3-sulfonamide
5-bromo-N-(2,2-difluoroethyl)-2-hydrazinyl-N-(2-hydroxyethyl)pyridine-3-sulfonamide (PubChem CID 107480748) has the molecular formula C9H13BrF2N4O3S
and a molecular weight of 375.20 g/mol. Its IUPAC name is 5-bromo-N-(2,2-difluoroethyl)-2-hydrazinyl-N-(2-hydroxyethyl)pyridine-3-sulfonamide.
Molecular Properties
| Compound Name | 5-bromo-N-(2,2-difluoroethyl)-2-hydrazinyl-N-(2-hydroxyethyl)pyridine-3-sulfonamide |
| PubChem CID | 107480748 |
| Molecular Formula | C9H13BrF2N4O3S |
| Molecular Weight | 375.20 g/mol |
| Exact Mass | 373.99 |
| IUPAC Name | 5-bromo-N-(2,2-difluoroethyl)-2-hydrazinyl-N-(2-hydroxyethyl)pyridine-3-sulfonamide |
| SMILES | NNc1ncc(Br)cc1S(=O)(=O)N(CCO)CC(F)F |
| InChI | InChI=1S/C9H13BrF2N4O3S/c10-6-3-7(9(15-13)14-4-6)20(18,19)16(1-2-17)5-8(11)12/h3-4,8,17H,1-2,5,13H2,(H,14,15) |
| InChIKey | ZRGCPHDGXNTRNK-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 108.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.20 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-N-(2,2-difluoroethyl)-2-hydrazinyl-N-(2-hydroxyethyl)pyridine-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-(2,2-difluoroethyl)-2-hydrazinyl-N-(2-hydroxyethyl)pyridine-3-sulfonamide?
The IUPAC name of 5-bromo-N-(2,2-difluoroethyl)-2-hydrazinyl-N-(2-hydroxyethyl)pyridine-3-sulfonamide (CID 107480748) is 5-bromo-N-(2,2-difluoroethyl)-2-hydrazinyl-N-(2-hydroxyethyl)pyridine-3-sulfonamide.
What is the SMILES notation for 5-bromo-N-(2,2-difluoroethyl)-2-hydrazinyl-N-(2-hydroxyethyl)pyridine-3-sulfonamide?
The canonical SMILES for 5-bromo-N-(2,2-difluoroethyl)-2-hydrazinyl-N-(2-hydroxyethyl)pyridine-3-sulfonamide is NNc1ncc(Br)cc1S(=O)(=O)N(CCO)CC(F)F.
What is the InChIKey of 5-bromo-N-(2,2-difluoroethyl)-2-hydrazinyl-N-(2-hydroxyethyl)pyridine-3-sulfonamide?
The InChIKey is ZRGCPHDGXNTRNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13BrF2N4O3S/c10-6-3-7(9(15-13)14-4-6)20(18,19)16(1-2-17)5-8(11)12/h3-4,8,17H,1-2,5,13H2,(H,14,15).
What are the key properties of 5-bromo-N-(2,2-difluoroethyl)-2-hydrazinyl-N-(2-hydroxyethyl)pyridine-3-sulfonamide?
5-bromo-N-(2,2-difluoroethyl)-2-hydrazinyl-N-(2-hydroxyethyl)pyridine-3-sulfonamide has a molecular weight of 375.20 g/mol, XLogP of 0.38, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-(2,2-difluoroethyl)-2-hydrazinyl-N-(2-hydroxyethyl)pyridine-3-sulfonamide is sourced from PubChem (CID 107480748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).