About (E)-4-[2,2-difluoroethyl(2-hydroxyethyl)amino]but-2-enoic acid
(E)-4-[2,2-difluoroethyl(2-hydroxyethyl)amino]but-2-enoic acid (PubChem CID 107480776) has the molecular formula C8H13F2NO3
and a molecular weight of 209.19 g/mol. Its IUPAC name is (E)-4-[2,2-difluoroethyl(2-hydroxyethyl)amino]but-2-enoic acid.
Molecular Properties
| Compound Name | (E)-4-[2,2-difluoroethyl(2-hydroxyethyl)amino]but-2-enoic acid |
| PubChem CID | 107480776 |
| Molecular Formula | C8H13F2NO3 |
| Molecular Weight | 209.19 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | (E)-4-[2,2-difluoroethyl(2-hydroxyethyl)amino]but-2-enoic acid |
| SMILES | O=C(O)/C=C/CN(CCO)CC(F)F |
| InChI | InChI=1S/C8H13F2NO3/c9-7(10)6-11(4-5-12)3-1-2-8(13)14/h1-2,7,12H,3-6H2,(H,13,14)/b2-1+ |
| InChIKey | JGAJZUPUMXVLCA-OWOJBTEDSA-N |
| XLogP | 0.19 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.19 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-[2,2-difluoroethyl(2-hydroxyethyl)amino]but-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-[2,2-difluoroethyl(2-hydroxyethyl)amino]but-2-enoic acid?
The IUPAC name of (E)-4-[2,2-difluoroethyl(2-hydroxyethyl)amino]but-2-enoic acid (CID 107480776) is (E)-4-[2,2-difluoroethyl(2-hydroxyethyl)amino]but-2-enoic acid.
What is the SMILES notation for (E)-4-[2,2-difluoroethyl(2-hydroxyethyl)amino]but-2-enoic acid?
The canonical SMILES for (E)-4-[2,2-difluoroethyl(2-hydroxyethyl)amino]but-2-enoic acid is O=C(O)/C=C/CN(CCO)CC(F)F.
What is the InChIKey of (E)-4-[2,2-difluoroethyl(2-hydroxyethyl)amino]but-2-enoic acid?
The InChIKey is JGAJZUPUMXVLCA-OWOJBTEDSA-N. The full InChI is InChI=1S/C8H13F2NO3/c9-7(10)6-11(4-5-12)3-1-2-8(13)14/h1-2,7,12H,3-6H2,(H,13,14)/b2-1+.
What are the key properties of (E)-4-[2,2-difluoroethyl(2-hydroxyethyl)amino]but-2-enoic acid?
(E)-4-[2,2-difluoroethyl(2-hydroxyethyl)amino]but-2-enoic acid has a molecular weight of 209.19 g/mol, XLogP of 0.19, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-[2,2-difluoroethyl(2-hydroxyethyl)amino]but-2-enoic acid is sourced from PubChem (CID 107480776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).