About ethyl 4-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]-4-hydroxycyclohexane-1-carboxylate
ethyl 4-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]-4-hydroxycyclohexane-1-carboxylate (PubChem CID 107480840) has the molecular formula C14H25F2NO4
and a molecular weight of 309.35 g/mol. Its IUPAC name is ethyl 4-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]-4-hydroxycyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]-4-hydroxycyclohexane-1-carboxylate |
| PubChem CID | 107480840 |
| Molecular Formula | C14H25F2NO4 |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | ethyl 4-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]-4-hydroxycyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(O)(CN(CCO)CC(F)F)CC1 |
| InChI | InChI=1S/C14H25F2NO4/c1-2-21-13(19)11-3-5-14(20,6-4-11)10-17(7-8-18)9-12(15)16/h11-12,18,20H,2-10H2,1H3 |
| InChIKey | RUDOVRRFRQGAKV-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 4-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]-4-hydroxycyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]-4-hydroxycyclohexane-1-carboxylate?
The IUPAC name of ethyl 4-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]-4-hydroxycyclohexane-1-carboxylate (CID 107480840) is ethyl 4-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]-4-hydroxycyclohexane-1-carboxylate.
What is the SMILES notation for ethyl 4-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]-4-hydroxycyclohexane-1-carboxylate?
The canonical SMILES for ethyl 4-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]-4-hydroxycyclohexane-1-carboxylate is CCOC(=O)C1CCC(O)(CN(CCO)CC(F)F)CC1.
What is the InChIKey of ethyl 4-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]-4-hydroxycyclohexane-1-carboxylate?
The InChIKey is RUDOVRRFRQGAKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25F2NO4/c1-2-21-13(19)11-3-5-14(20,6-4-11)10-17(7-8-18)9-12(15)16/h11-12,18,20H,2-10H2,1H3.
What are the key properties of ethyl 4-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]-4-hydroxycyclohexane-1-carboxylate?
ethyl 4-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]-4-hydroxycyclohexane-1-carboxylate has a molecular weight of 309.35 g/mol, XLogP of 1.03, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]-4-hydroxycyclohexane-1-carboxylate is sourced from PubChem (CID 107480840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).