About 2-[[4-chloro-5-(hydroxymethyl)-1,3-thiazol-2-yl]-(2,2-difluoroethyl)amino]ethanol
2-[[4-chloro-5-(hydroxymethyl)-1,3-thiazol-2-yl]-(2,2-difluoroethyl)amino]ethanol (PubChem CID 107481017) has the molecular formula C8H11ClF2N2O2S
and a molecular weight of 272.70 g/mol. Its IUPAC name is 2-[[4-chloro-5-(hydroxymethyl)-1,3-thiazol-2-yl]-(2,2-difluoroethyl)amino]ethanol.
Molecular Properties
| Compound Name | 2-[[4-chloro-5-(hydroxymethyl)-1,3-thiazol-2-yl]-(2,2-difluoroethyl)amino]ethanol |
| PubChem CID | 107481017 |
| Molecular Formula | C8H11ClF2N2O2S |
| Molecular Weight | 272.70 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | 2-[[4-chloro-5-(hydroxymethyl)-1,3-thiazol-2-yl]-(2,2-difluoroethyl)amino]ethanol |
| SMILES | OCCN(CC(F)F)c1nc(Cl)c(CO)s1 |
| InChI | InChI=1S/C8H11ClF2N2O2S/c9-7-5(4-15)16-8(12-7)13(1-2-14)3-6(10)11/h6,14-15H,1-4H2 |
| InChIKey | FHSZYWMQLFUASF-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 56.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.70 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[4-chloro-5-(hydroxymethyl)-1,3-thiazol-2-yl]-(2,2-difluoroethyl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4-chloro-5-(hydroxymethyl)-1,3-thiazol-2-yl]-(2,2-difluoroethyl)amino]ethanol?
The IUPAC name of 2-[[4-chloro-5-(hydroxymethyl)-1,3-thiazol-2-yl]-(2,2-difluoroethyl)amino]ethanol (CID 107481017) is 2-[[4-chloro-5-(hydroxymethyl)-1,3-thiazol-2-yl]-(2,2-difluoroethyl)amino]ethanol.
What is the SMILES notation for 2-[[4-chloro-5-(hydroxymethyl)-1,3-thiazol-2-yl]-(2,2-difluoroethyl)amino]ethanol?
The canonical SMILES for 2-[[4-chloro-5-(hydroxymethyl)-1,3-thiazol-2-yl]-(2,2-difluoroethyl)amino]ethanol is OCCN(CC(F)F)c1nc(Cl)c(CO)s1.
What is the InChIKey of 2-[[4-chloro-5-(hydroxymethyl)-1,3-thiazol-2-yl]-(2,2-difluoroethyl)amino]ethanol?
The InChIKey is FHSZYWMQLFUASF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11ClF2N2O2S/c9-7-5(4-15)16-8(12-7)13(1-2-14)3-6(10)11/h6,14-15H,1-4H2.
What are the key properties of 2-[[4-chloro-5-(hydroxymethyl)-1,3-thiazol-2-yl]-(2,2-difluoroethyl)amino]ethanol?
2-[[4-chloro-5-(hydroxymethyl)-1,3-thiazol-2-yl]-(2,2-difluoroethyl)amino]ethanol has a molecular weight of 272.70 g/mol, XLogP of 1.35, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-chloro-5-(hydroxymethyl)-1,3-thiazol-2-yl]-(2,2-difluoroethyl)amino]ethanol is sourced from PubChem (CID 107481017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).