C13H16ClF2NO3 — CID 107481196
1-[5-chloro-3-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]-2-hydroxyphenyl]ethanone (PubChem CID 107481196) has the molecular formula C13H16ClF2NO3 and a molecular weight of 307.72 g/mol. Its IUPAC name is 1-[5-chloro-3-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]-2-hydroxyphenyl]ethanone.
| Compound Name | 1-[5-chloro-3-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]-2-hydroxyphenyl]ethanone |
|---|---|
| PubChem CID | 107481196 |
| Molecular Formula | C13H16ClF2NO3 |
| Molecular Weight | 307.72 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 1-[5-chloro-3-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]-2-hydroxyphenyl]ethanone |
| SMILES | CC(=O)c1cc(Cl)cc(CN(CCO)CC(F)F)c1O |
| InChI | InChI=1S/C13H16ClF2NO3/c1-8(19)11-5-10(14)4-9(13(11)20)6-17(2-3-18)7-12(15)16/h4-5,12,18,20H,2-3,6-7H2,1H3 |
| InChIKey | MHSRJZPFSVFQNV-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.72 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|