About 1-[2,2-difluoroethyl(2-hydroxyethyl)amino]-3,3-dimethylbutan-2-one
1-[2,2-difluoroethyl(2-hydroxyethyl)amino]-3,3-dimethylbutan-2-one (PubChem CID 107481227) has the molecular formula C10H19F2NO2
and a molecular weight of 223.26 g/mol. Its IUPAC name is 1-[2,2-difluoroethyl(2-hydroxyethyl)amino]-3,3-dimethylbutan-2-one.
Molecular Properties
| Compound Name | 1-[2,2-difluoroethyl(2-hydroxyethyl)amino]-3,3-dimethylbutan-2-one |
| PubChem CID | 107481227 |
| Molecular Formula | C10H19F2NO2 |
| Molecular Weight | 223.26 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 1-[2,2-difluoroethyl(2-hydroxyethyl)amino]-3,3-dimethylbutan-2-one |
| SMILES | CC(C)(C)C(=O)CN(CCO)CC(F)F |
| InChI | InChI=1S/C10H19F2NO2/c1-10(2,3)8(15)6-13(4-5-14)7-9(11)12/h9,14H,4-7H2,1-3H3 |
| InChIKey | BUTQAZYASADFSG-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.26 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[2,2-difluoroethyl(2-hydroxyethyl)amino]-3,3-dimethylbutan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2,2-difluoroethyl(2-hydroxyethyl)amino]-3,3-dimethylbutan-2-one?
The IUPAC name of 1-[2,2-difluoroethyl(2-hydroxyethyl)amino]-3,3-dimethylbutan-2-one (CID 107481227) is 1-[2,2-difluoroethyl(2-hydroxyethyl)amino]-3,3-dimethylbutan-2-one.
What is the SMILES notation for 1-[2,2-difluoroethyl(2-hydroxyethyl)amino]-3,3-dimethylbutan-2-one?
The canonical SMILES for 1-[2,2-difluoroethyl(2-hydroxyethyl)amino]-3,3-dimethylbutan-2-one is CC(C)(C)C(=O)CN(CCO)CC(F)F.
What is the InChIKey of 1-[2,2-difluoroethyl(2-hydroxyethyl)amino]-3,3-dimethylbutan-2-one?
The InChIKey is BUTQAZYASADFSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19F2NO2/c1-10(2,3)8(15)6-13(4-5-14)7-9(11)12/h9,14H,4-7H2,1-3H3.
What are the key properties of 1-[2,2-difluoroethyl(2-hydroxyethyl)amino]-3,3-dimethylbutan-2-one?
1-[2,2-difluoroethyl(2-hydroxyethyl)amino]-3,3-dimethylbutan-2-one has a molecular weight of 223.26 g/mol, XLogP of 1.16, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2,2-difluoroethyl(2-hydroxyethyl)amino]-3,3-dimethylbutan-2-one is sourced from PubChem (CID 107481227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).