C34H37N9O12S3 — CID 10748158
3,6,10-tris[(2-nitrophenyl)sulfonyl]-14-piperazin-1-yl-3,6,10,16-tetrazabicyclo[10.3.1]hexadeca-1(15),12(16),13-triene (PubChem CID 10748158) has the molecular formula C34H37N9O12S3 and a molecular weight of 859.92 g/mol. Its IUPAC name is 3,6,10-tris[(2-nitrophenyl)sulfonyl]-14-piperazin-1-yl-3,6,10,16-tetrazabicyclo[10.3.1]hexadeca-1(15),12(16),13-triene.
| Compound Name | 3,6,10-tris[(2-nitrophenyl)sulfonyl]-14-piperazin-1-yl-3,6,10,16-tetrazabicyclo[10.3.1]hexadeca-1(15),12(16),13-triene |
|---|---|
| PubChem CID | 10748158 |
| Molecular Formula | C34H37N9O12S3 |
| Molecular Weight | 859.92 g/mol |
| Exact Mass | 859.17 |
| IUPAC Name | 3,6,10-tris[(2-nitrophenyl)sulfonyl]-14-piperazin-1-yl-3,6,10,16-tetrazabicyclo[10.3.1]hexadeca-1(15),12(16),13-triene |
| SMILES | O=[N+]([O-])c1ccccc1S(=O)(=O)N1CCCN(S(=O)(=O)c2ccccc2[N+](=O)[O-])Cc2cc(N3CCNCC3)cc(n2)CN(S(=O)(=O)c2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C34H37N9O12S3/c44-41(45)29-8-1-4-11-32(29)56(50,51)38-16-7-17-39(57(52,53)33-12-5-2-9-30(33)42(46)47)24-26-22-28(37-18-14-35-15-19-37)23-27(36-26)25-40(21-20-38)58(54,55)34-13-6-3-10-31(34)43(48)49/h1-6,8-13,22-23,35H,7,14-21,24-25H2 |
| InChIKey | RTBCMZCUIMLZGW-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 269.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.92 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|