About 3-[[2,2-difluoroethyl(2-hydroxyethyl)carbamoyl]amino]oxolane-3-carboxylic acid
3-[[2,2-difluoroethyl(2-hydroxyethyl)carbamoyl]amino]oxolane-3-carboxylic acid (PubChem CID 107481790) has the molecular formula C10H16F2N2O5
and a molecular weight of 282.24 g/mol. Its IUPAC name is 3-[[2,2-difluoroethyl(2-hydroxyethyl)carbamoyl]amino]oxolane-3-carboxylic acid.
Molecular Properties
| Compound Name | 3-[[2,2-difluoroethyl(2-hydroxyethyl)carbamoyl]amino]oxolane-3-carboxylic acid |
| PubChem CID | 107481790 |
| Molecular Formula | C10H16F2N2O5 |
| Molecular Weight | 282.24 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 3-[[2,2-difluoroethyl(2-hydroxyethyl)carbamoyl]amino]oxolane-3-carboxylic acid |
| SMILES | O=C(NC1(C(=O)O)CCOC1)N(CCO)CC(F)F |
| InChI | InChI=1S/C10H16F2N2O5/c11-7(12)5-14(2-3-15)9(18)13-10(8(16)17)1-4-19-6-10/h7,15H,1-6H2,(H,13,18)(H,16,17) |
| InChIKey | CBMACNWJGUZGOT-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.24 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[[2,2-difluoroethyl(2-hydroxyethyl)carbamoyl]amino]oxolane-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2,2-difluoroethyl(2-hydroxyethyl)carbamoyl]amino]oxolane-3-carboxylic acid?
The IUPAC name of 3-[[2,2-difluoroethyl(2-hydroxyethyl)carbamoyl]amino]oxolane-3-carboxylic acid (CID 107481790) is 3-[[2,2-difluoroethyl(2-hydroxyethyl)carbamoyl]amino]oxolane-3-carboxylic acid.
What is the SMILES notation for 3-[[2,2-difluoroethyl(2-hydroxyethyl)carbamoyl]amino]oxolane-3-carboxylic acid?
The canonical SMILES for 3-[[2,2-difluoroethyl(2-hydroxyethyl)carbamoyl]amino]oxolane-3-carboxylic acid is O=C(NC1(C(=O)O)CCOC1)N(CCO)CC(F)F.
What is the InChIKey of 3-[[2,2-difluoroethyl(2-hydroxyethyl)carbamoyl]amino]oxolane-3-carboxylic acid?
The InChIKey is CBMACNWJGUZGOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16F2N2O5/c11-7(12)5-14(2-3-15)9(18)13-10(8(16)17)1-4-19-6-10/h7,15H,1-6H2,(H,13,18)(H,16,17).
What are the key properties of 3-[[2,2-difluoroethyl(2-hydroxyethyl)carbamoyl]amino]oxolane-3-carboxylic acid?
3-[[2,2-difluoroethyl(2-hydroxyethyl)carbamoyl]amino]oxolane-3-carboxylic acid has a molecular weight of 282.24 g/mol, XLogP of -0.50, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2,2-difluoroethyl(2-hydroxyethyl)carbamoyl]amino]oxolane-3-carboxylic acid is sourced from PubChem (CID 107481790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).