C10H14ClF3N2OS — CID 107482055
2-[1-[4-(chloromethyl)-1,3-thiazol-2-yl]ethyl-(2,2,2-trifluoroethyl)amino]ethanol (PubChem CID 107482055) has the molecular formula C10H14ClF3N2OS and a molecular weight of 302.75 g/mol. Its IUPAC name is 2-[1-[4-(chloromethyl)-1,3-thiazol-2-yl]ethyl-(2,2,2-trifluoroethyl)amino]ethanol.
| Compound Name | 2-[1-[4-(chloromethyl)-1,3-thiazol-2-yl]ethyl-(2,2,2-trifluoroethyl)amino]ethanol |
|---|---|
| PubChem CID | 107482055 |
| Molecular Formula | C10H14ClF3N2OS |
| Molecular Weight | 302.75 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 2-[1-[4-(chloromethyl)-1,3-thiazol-2-yl]ethyl-(2,2,2-trifluoroethyl)amino]ethanol |
| SMILES | CC(c1nc(CCl)cs1)N(CCO)CC(F)(F)F |
| InChI | InChI=1S/C10H14ClF3N2OS/c1-7(9-15-8(4-11)5-18-9)16(2-3-17)6-10(12,13)14/h5,7,17H,2-4,6H2,1H3 |
| InChIKey | WPPVVHNTMJNXBI-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.75 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|