C11H16ClF3N2OS — CID 107482057
2-[1-[4-(chloromethyl)-1,3-thiazol-2-yl]propyl-(2,2,2-trifluoroethyl)amino]ethanol (PubChem CID 107482057) has the molecular formula C11H16ClF3N2OS and a molecular weight of 316.78 g/mol. Its IUPAC name is 2-[1-[4-(chloromethyl)-1,3-thiazol-2-yl]propyl-(2,2,2-trifluoroethyl)amino]ethanol.
| Compound Name | 2-[1-[4-(chloromethyl)-1,3-thiazol-2-yl]propyl-(2,2,2-trifluoroethyl)amino]ethanol |
|---|---|
| PubChem CID | 107482057 |
| Molecular Formula | C11H16ClF3N2OS |
| Molecular Weight | 316.78 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 2-[1-[4-(chloromethyl)-1,3-thiazol-2-yl]propyl-(2,2,2-trifluoroethyl)amino]ethanol |
| SMILES | CCC(c1nc(CCl)cs1)N(CCO)CC(F)(F)F |
| InChI | InChI=1S/C11H16ClF3N2OS/c1-2-9(10-16-8(5-12)6-19-10)17(3-4-18)7-11(13,14)15/h6,9,18H,2-5,7H2,1H3 |
| InChIKey | ADVNCWLNESKQSF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.78 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|