C12H18ClF3N2OS — CID 107482058
2-[4-[4-(chloromethyl)-1,3-thiazol-2-yl]butyl-(2,2,2-trifluoroethyl)amino]ethanol (PubChem CID 107482058) has the molecular formula C12H18ClF3N2OS and a molecular weight of 330.80 g/mol. Its IUPAC name is 2-[4-[4-(chloromethyl)-1,3-thiazol-2-yl]butyl-(2,2,2-trifluoroethyl)amino]ethanol.
| Compound Name | 2-[4-[4-(chloromethyl)-1,3-thiazol-2-yl]butyl-(2,2,2-trifluoroethyl)amino]ethanol |
|---|---|
| PubChem CID | 107482058 |
| Molecular Formula | C12H18ClF3N2OS |
| Molecular Weight | 330.80 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 2-[4-[4-(chloromethyl)-1,3-thiazol-2-yl]butyl-(2,2,2-trifluoroethyl)amino]ethanol |
| SMILES | OCCN(CCCCc1nc(CCl)cs1)CC(F)(F)F |
| InChI | InChI=1S/C12H18ClF3N2OS/c13-7-10-8-20-11(17-10)3-1-2-4-18(5-6-19)9-12(14,15)16/h8,19H,1-7,9H2 |
| InChIKey | JGHLGPGVOVUMTG-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.80 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|